C19H23ClFN7 — CID 163281076
2-N-[(E)-1-amino-3-cyclohexyliminoprop-1-en-2-yl]-4-N-(5-amino-2-fluorophenyl)-5-chloropyrimidine-2,4-diamine (PubChem CID 163281076) has the molecular formula C19H23ClFN7 and a molecular weight of 403.89 g/mol. Its IUPAC name is 2-N-[(E)-1-amino-3-cyclohexyliminoprop-1-en-2-yl]-4-N-(5-amino-2-fluorophenyl)-5-chloropyrimidine-2,4-diamine.
| Compound Name | 2-N-[(E)-1-amino-3-cyclohexyliminoprop-1-en-2-yl]-4-N-(5-amino-2-fluorophenyl)-5-chloropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163281076 |
| Molecular Formula | C19H23ClFN7 |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 2-N-[(E)-1-amino-3-cyclohexyliminoprop-1-en-2-yl]-4-N-(5-amino-2-fluorophenyl)-5-chloropyrimidine-2,4-diamine |
| SMILES | N/C=C(\C=N\C1CCCCC1)Nc1ncc(Cl)c(Nc2cc(N)ccc2F)n1 |
| InChI | InChI=1S/C19H23ClFN7/c20-15-11-25-19(26-14(9-22)10-24-13-4-2-1-3-5-13)28-18(15)27-17-8-12(23)6-7-16(17)21/h6-11,13H,1-5,22-23H2,(H2,25,26,27,28)/b14-9+,24-10+ |
| InChIKey | WYUPWZMTKHLEPC-ZRRYWOCVSA-N |
| XLogP | 4.21 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|