C17H21N5 — CID 123601431
3-N-[4-(cyclohexen-1-yl)-6-methyl-1,3,5-triazin-2-yl]-4-methylbenzene-1,3-diamine (PubChem CID 123601431) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-N-[4-(cyclohexen-1-yl)-6-methyl-1,3,5-triazin-2-yl]-4-methylbenzene-1,3-diamine.
| Compound Name | 3-N-[4-(cyclohexen-1-yl)-6-methyl-1,3,5-triazin-2-yl]-4-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 123601431 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 3-N-[4-(cyclohexen-1-yl)-6-methyl-1,3,5-triazin-2-yl]-4-methylbenzene-1,3-diamine |
| SMILES | Cc1nc(Nc2cc(N)ccc2C)nc(C2=CCCCC2)n1 |
| InChI | InChI=1S/C17H21N5/c1-11-8-9-14(18)10-15(11)21-17-20-12(2)19-16(22-17)13-6-4-3-5-7-13/h6,8-10H,3-5,7,18H2,1-2H3,(H,19,20,21,22) |
| InChIKey | AZSVVSVSRNEBCX-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|