C17H19FN8O6S — CID 145288613
2-amino-N-[[(2R,3R,4R)-4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-4-fluorobenzamide (PubChem CID 145288613) has the molecular formula C17H19FN8O6S and a molecular weight of 482.45 g/mol. Its IUPAC name is 2-amino-N-[[(2R,3R,4R)-4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-4-fluorobenzamide.
| Compound Name | 2-amino-N-[[(2R,3R,4R)-4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 145288613 |
| Molecular Formula | C17H19FN8O6S |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 2-amino-N-[[(2R,3R,4R)-4-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methylsulfamoyl]-4-fluorobenzamide |
| SMILES | Nc1cc(F)ccc1C(=O)NS(=O)(=O)NC[C@H]1OC[C@](O)(n2cnc3c(N)ncnc32)[C@@H]1O |
| InChI | InChI=1S/C17H19FN8O6S/c18-8-1-2-9(10(19)3-8)16(28)25-33(30,31)24-4-11-13(27)17(29,5-32-11)26-7-23-12-14(20)21-6-22-15(12)26/h1-3,6-7,11,13,24,27,29H,4-5,19H2,(H,25,28)(H2,20,21,22)/t11-,13-,17-/m1/s1 |
| InChIKey | LSMONCVWMHLXES-CJBNDPTMSA-N |
| XLogP | -2.20 |
| TPSA | 220.60 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|