C28H36ClN5OS — CID 145290700
N-(3-chloropropylsulfanyl)methanamine;6-[3-(dimethylamino)anilino]-5-(2-methylpropanimidoyl)-4-phenylpyridine-2-carbaldehyde (PubChem CID 145290700) has the molecular formula C28H36ClN5OS and a molecular weight of 526.15 g/mol. Its IUPAC name is N-(3-chloropropylsulfanyl)methanamine;6-[3-(dimethylamino)anilino]-5-(2-methylpropanimidoyl)-4-phenylpyridine-2-carbaldehyde.
| Compound Name | N-(3-chloropropylsulfanyl)methanamine;6-[3-(dimethylamino)anilino]-5-(2-methylpropanimidoyl)-4-phenylpyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 145290700 |
| Molecular Formula | C28H36ClN5OS |
| Molecular Weight | 526.15 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | N-(3-chloropropylsulfanyl)methanamine;6-[3-(dimethylamino)anilino]-5-(2-methylpropanimidoyl)-4-phenylpyridine-2-carbaldehyde |
| SMILES | CNSCCCCl.[H]/N=C(/c1c(-c2ccccc2)cc(C=O)nc1Nc1cccc(N(C)C)c1)C(C)C |
| InChI | InChI=1S/C24H26N4O.C4H10ClNS/c1-16(2)23(25)22-21(17-9-6-5-7-10-17)14-19(15-29)27-24(22)26-18-11-8-12-20(13-18)28(3)4;1-6-7-4-2-3-5/h5-16,25H,1-4H3,(H,26,27);6H,2-4H2,1H3/b25-23+; |
| InChIKey | YUACNUOMBOFEOF-PHEASTCWSA-N |
| XLogP | 6.88 |
| TPSA | 81.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.15 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|