C16H15F2N3O3 — CID 162359541
6-[3-(difluoromethoxy)anilino]-5-[(2S)-2-hydroxypropanimidoyl]pyridine-3-carbaldehyde (PubChem CID 162359541) has the molecular formula C16H15F2N3O3 and a molecular weight of 335.31 g/mol. Its IUPAC name is 6-[3-(difluoromethoxy)anilino]-5-[(2S)-2-hydroxypropanimidoyl]pyridine-3-carbaldehyde.
| Compound Name | 6-[3-(difluoromethoxy)anilino]-5-[(2S)-2-hydroxypropanimidoyl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 162359541 |
| Molecular Formula | C16H15F2N3O3 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 6-[3-(difluoromethoxy)anilino]-5-[(2S)-2-hydroxypropanimidoyl]pyridine-3-carbaldehyde |
| SMILES | [H]/N=C(/c1cc(C=O)cnc1Nc1cccc(OC(F)F)c1)[C@H](C)O |
| InChI | InChI=1S/C16H15F2N3O3/c1-9(23)14(19)13-5-10(8-22)7-20-15(13)21-11-3-2-4-12(6-11)24-16(17)18/h2-9,16,19,23H,1H3,(H,20,21)/b19-14+/t9-/m0/s1 |
| InChIKey | NTESPNSABUXKLV-RCNKJQFBSA-N |
| XLogP | 2.99 |
| TPSA | 95.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|