C23H33F2N5O2S — CID 162359498
6-[[5-(difluoromethoxy)-3-pyridinyl]amino]-5-(2-methylpropanimidoyl)pyridine-3-carbaldehyde;N,3-dimethylthietan-3-amine;ethane (PubChem CID 162359498) has the molecular formula C23H33F2N5O2S and a molecular weight of 481.61 g/mol. Its IUPAC name is 6-[[5-(difluoromethoxy)-3-pyridinyl]amino]-5-(2-methylpropanimidoyl)pyridine-3-carbaldehyde;N,3-dimethylthietan-3-amine;ethane.
| Compound Name | 6-[[5-(difluoromethoxy)-3-pyridinyl]amino]-5-(2-methylpropanimidoyl)pyridine-3-carbaldehyde;N,3-dimethylthietan-3-amine;ethane |
|---|---|
| PubChem CID | 162359498 |
| Molecular Formula | C23H33F2N5O2S |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 6-[[5-(difluoromethoxy)-3-pyridinyl]amino]-5-(2-methylpropanimidoyl)pyridine-3-carbaldehyde;N,3-dimethylthietan-3-amine;ethane |
| SMILES | CC.CNC1(C)CSC1.[H]/N=C(/c1cc(C=O)cnc1Nc1cncc(OC(F)F)c1)C(C)C |
| InChI | InChI=1S/C16H16F2N4O2.C5H11NS.C2H6/c1-9(2)14(19)13-3-10(8-23)5-21-15(13)22-11-4-12(7-20-6-11)24-16(17)18;1-5(6-2)3-7-4-5;1-2/h3-9,16,19H,1-2H3,(H,21,22);6H,3-4H2,1-2H3;1-2H3/b19-14+;; |
| InChIKey | IHOMNKFENUVXFV-ZWXFCGGNSA-N |
| XLogP | 5.40 |
| TPSA | 99.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|