C24H31F2N5O3S — CID 162359043
5-[5-(difluoromethoxy)pyridine-3-carboximidoyl]-4-(oxan-4-ylamino)pyridine-2-carbaldehyde;N,3-dimethylthiolan-3-amine (PubChem CID 162359043) has the molecular formula C24H31F2N5O3S and a molecular weight of 507.61 g/mol. Its IUPAC name is 5-[5-(difluoromethoxy)pyridine-3-carboximidoyl]-4-(oxan-4-ylamino)pyridine-2-carbaldehyde;N,3-dimethylthiolan-3-amine.
| Compound Name | 5-[5-(difluoromethoxy)pyridine-3-carboximidoyl]-4-(oxan-4-ylamino)pyridine-2-carbaldehyde;N,3-dimethylthiolan-3-amine |
|---|---|
| PubChem CID | 162359043 |
| Molecular Formula | C24H31F2N5O3S |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | 5-[5-(difluoromethoxy)pyridine-3-carboximidoyl]-4-(oxan-4-ylamino)pyridine-2-carbaldehyde;N,3-dimethylthiolan-3-amine |
| SMILES | CNC1(C)CCSC1.[H]/N=C(\c1cncc(OC(F)F)c1)c1cnc(C=O)cc1NC1CCOCC1 |
| InChI | InChI=1S/C18H18F2N4O3.C6H13NS/c19-18(20)27-14-5-11(7-22-8-14)17(21)15-9-23-13(10-25)6-16(15)24-12-1-3-26-4-2-12;1-6(7-2)3-4-8-5-6/h5-10,12,18,21H,1-4H2,(H,23,24);7H,3-5H2,1-2H3/b21-17+; |
| InChIKey | YWIYXQBNRZFZMW-DIRYEVLESA-N |
| XLogP | 4.00 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|