C21H24F2N4O3S — CID 162359446
4-[[5-(difluoromethoxy)-3-pyridinyl]amino]-N-(3-methyl-1-oxothietan-3-yl)-3-(2-methylpropanimidoyl)benzamide (PubChem CID 162359446) has the molecular formula C21H24F2N4O3S and a molecular weight of 450.51 g/mol. Its IUPAC name is 4-[[5-(difluoromethoxy)-3-pyridinyl]amino]-N-(3-methyl-1-oxothietan-3-yl)-3-(2-methylpropanimidoyl)benzamide.
| Compound Name | 4-[[5-(difluoromethoxy)-3-pyridinyl]amino]-N-(3-methyl-1-oxothietan-3-yl)-3-(2-methylpropanimidoyl)benzamide |
|---|---|
| PubChem CID | 162359446 |
| Molecular Formula | C21H24F2N4O3S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 4-[[5-(difluoromethoxy)-3-pyridinyl]amino]-N-(3-methyl-1-oxothietan-3-yl)-3-(2-methylpropanimidoyl)benzamide |
| SMILES | [H]/N=C(/c1cc(C(=O)NC2(C)CS(=O)C2)ccc1Nc1cncc(OC(F)F)c1)C(C)C |
| InChI | InChI=1S/C21H24F2N4O3S/c1-12(2)18(24)16-6-13(19(28)27-21(3)10-31(29)11-21)4-5-17(16)26-14-7-15(9-25-8-14)30-20(22)23/h4-9,12,20,24,26H,10-11H2,1-3H3,(H,27,28)/b24-18+ |
| InChIKey | OMCNEENEPLDBKE-HKOYGPOVSA-N |
| XLogP | 3.70 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|