C23H30F2N4O3S — CID 162359506
6-[3-(difluoromethoxy)anilino]-5-(2-methylpropanimidoyl)pyridine-3-carbaldehyde;N,3-dimethyl-1-oxothiolan-3-amine (PubChem CID 162359506) has the molecular formula C23H30F2N4O3S and a molecular weight of 480.58 g/mol. Its IUPAC name is 6-[3-(difluoromethoxy)anilino]-5-(2-methylpropanimidoyl)pyridine-3-carbaldehyde;N,3-dimethyl-1-oxothiolan-3-amine.
| Compound Name | 6-[3-(difluoromethoxy)anilino]-5-(2-methylpropanimidoyl)pyridine-3-carbaldehyde;N,3-dimethyl-1-oxothiolan-3-amine |
|---|---|
| PubChem CID | 162359506 |
| Molecular Formula | C23H30F2N4O3S |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | 6-[3-(difluoromethoxy)anilino]-5-(2-methylpropanimidoyl)pyridine-3-carbaldehyde;N,3-dimethyl-1-oxothiolan-3-amine |
| SMILES | CNC1(C)CCS(=O)C1.[H]/N=C(/c1cc(C=O)cnc1Nc1cccc(OC(F)F)c1)C(C)C |
| InChI | InChI=1S/C17H17F2N3O2.C6H13NOS/c1-10(2)15(20)14-6-11(9-23)8-21-16(14)22-12-4-3-5-13(7-12)24-17(18)19;1-6(7-2)3-4-9(8)5-6/h3-10,17,20H,1-2H3,(H,21,22);7H,3-5H2,1-2H3/b20-15+; |
| InChIKey | PJKGLTNLLLATSB-QMGGKDRNSA-N |
| XLogP | 4.38 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|