C25H32F2N4O3S — CID 162359349
6-[3-(difluoromethoxy)benzenecarboximidoyl]-5-(oxan-4-ylmethylamino)pyridine-3-carbaldehyde;N,3-dimethylthietan-3-amine (PubChem CID 162359349) has the molecular formula C25H32F2N4O3S and a molecular weight of 506.62 g/mol. Its IUPAC name is 6-[3-(difluoromethoxy)benzenecarboximidoyl]-5-(oxan-4-ylmethylamino)pyridine-3-carbaldehyde;N,3-dimethylthietan-3-amine.
| Compound Name | 6-[3-(difluoromethoxy)benzenecarboximidoyl]-5-(oxan-4-ylmethylamino)pyridine-3-carbaldehyde;N,3-dimethylthietan-3-amine |
|---|---|
| PubChem CID | 162359349 |
| Molecular Formula | C25H32F2N4O3S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 6-[3-(difluoromethoxy)benzenecarboximidoyl]-5-(oxan-4-ylmethylamino)pyridine-3-carbaldehyde;N,3-dimethylthietan-3-amine |
| SMILES | CNC1(C)CSC1.[H]/N=C(\c1cccc(OC(F)F)c1)c1ncc(C=O)cc1NCC1CCOCC1 |
| InChI | InChI=1S/C20H21F2N3O3.C5H11NS/c21-20(22)28-16-3-1-2-15(9-16)18(23)19-17(8-14(12-26)11-25-19)24-10-13-4-6-27-7-5-13;1-5(6-2)3-7-4-5/h1-3,8-9,11-13,20,23-24H,4-7,10H2;6H,3-4H2,1-2H3/b23-18+; |
| InChIKey | YRDQTSRNTQIITR-XHMOQMQQSA-N |
| XLogP | 4.46 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|