C27H35F2N3O3S — CID 162359392
4-[3-(difluoromethoxy)benzenecarboximidoyl]-3-methyl-5-(oxan-4-ylamino)benzaldehyde;N,3-dimethylthiolan-3-amine (PubChem CID 162359392) has the molecular formula C27H35F2N3O3S and a molecular weight of 519.66 g/mol. Its IUPAC name is 4-[3-(difluoromethoxy)benzenecarboximidoyl]-3-methyl-5-(oxan-4-ylamino)benzaldehyde;N,3-dimethylthiolan-3-amine.
| Compound Name | 4-[3-(difluoromethoxy)benzenecarboximidoyl]-3-methyl-5-(oxan-4-ylamino)benzaldehyde;N,3-dimethylthiolan-3-amine |
|---|---|
| PubChem CID | 162359392 |
| Molecular Formula | C27H35F2N3O3S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | 4-[3-(difluoromethoxy)benzenecarboximidoyl]-3-methyl-5-(oxan-4-ylamino)benzaldehyde;N,3-dimethylthiolan-3-amine |
| SMILES | CNC1(C)CCSC1.[H]/N=C(\c1cccc(OC(F)F)c1)c1c(C)cc(C=O)cc1NC1CCOCC1 |
| InChI | InChI=1S/C21H22F2N2O3.C6H13NS/c1-13-9-14(12-26)10-18(25-16-5-7-27-8-6-16)19(13)20(24)15-3-2-4-17(11-15)28-21(22)23;1-6(7-2)3-4-8-5-6/h2-4,9-12,16,21,24-25H,5-8H2,1H3;7H,3-5H2,1-2H3/b24-20+; |
| InChIKey | USJDKAYGZPUQOJ-UUTNPJQJSA-N |
| XLogP | 5.52 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|