C24H31F2N3O2S — CID 162359648
1-[3-(difluoromethoxy)phenyl]-3-methylindazole-5-carbaldehyde;N,3-dimethylthiolan-3-amine;ethane (PubChem CID 162359648) has the molecular formula C24H31F2N3O2S and a molecular weight of 463.59 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)phenyl]-3-methylindazole-5-carbaldehyde;N,3-dimethylthiolan-3-amine;ethane.
| Compound Name | 1-[3-(difluoromethoxy)phenyl]-3-methylindazole-5-carbaldehyde;N,3-dimethylthiolan-3-amine;ethane |
|---|---|
| PubChem CID | 162359648 |
| Molecular Formula | C24H31F2N3O2S |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 1-[3-(difluoromethoxy)phenyl]-3-methylindazole-5-carbaldehyde;N,3-dimethylthiolan-3-amine;ethane |
| SMILES | CC.CNC1(C)CCSC1.Cc1nn(-c2cccc(OC(F)F)c2)c2ccc(C=O)cc12 |
| InChI | InChI=1S/C16H12F2N2O2.C6H13NS.C2H6/c1-10-14-7-11(9-21)5-6-15(14)20(19-10)12-3-2-4-13(8-12)22-16(17)18;1-6(7-2)3-4-8-5-6;1-2/h2-9,16H,1H3;7H,3-5H2,1-2H3;1-2H3 |
| InChIKey | JKSXZYKMRLILHI-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|