C20H20F2N2O4 — CID 162359645
4-[3-(difluoromethoxy)anilino]-3-(4-hydroxyoxane-4-carboximidoyl)benzaldehyde (PubChem CID 162359645) has the molecular formula C20H20F2N2O4 and a molecular weight of 390.39 g/mol. Its IUPAC name is 4-[3-(difluoromethoxy)anilino]-3-(4-hydroxyoxane-4-carboximidoyl)benzaldehyde.
| Compound Name | 4-[3-(difluoromethoxy)anilino]-3-(4-hydroxyoxane-4-carboximidoyl)benzaldehyde |
|---|---|
| PubChem CID | 162359645 |
| Molecular Formula | C20H20F2N2O4 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 4-[3-(difluoromethoxy)anilino]-3-(4-hydroxyoxane-4-carboximidoyl)benzaldehyde |
| SMILES | [H]/N=C(/c1cc(C=O)ccc1Nc1cccc(OC(F)F)c1)C1(O)CCOCC1 |
| InChI | InChI=1S/C20H20F2N2O4/c21-19(22)28-15-3-1-2-14(11-15)24-17-5-4-13(12-25)10-16(17)18(23)20(26)6-8-27-9-7-20/h1-5,10-12,19,23-24,26H,6-9H2/b23-18- |
| InChIKey | QOSRCXUZFMBGDI-NKFKGCMQSA-N |
| XLogP | 3.75 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|