C15H11F2IN2O3 — CID 162359613
3-carbonimidiodidoyl-4-[3-(difluoromethoxy)anilino]benzoic acid (PubChem CID 162359613) has the molecular formula C15H11F2IN2O3 and a molecular weight of 432.16 g/mol. Its IUPAC name is 3-carbonimidiodidoyl-4-[3-(difluoromethoxy)anilino]benzoic acid.
| Compound Name | 3-carbonimidiodidoyl-4-[3-(difluoromethoxy)anilino]benzoic acid |
|---|---|
| PubChem CID | 162359613 |
| Molecular Formula | C15H11F2IN2O3 |
| Molecular Weight | 432.16 g/mol |
| Exact Mass | 431.98 |
| IUPAC Name | 3-carbonimidiodidoyl-4-[3-(difluoromethoxy)anilino]benzoic acid |
| SMILES | [H]/N=C(\I)c1cc(C(=O)O)ccc1Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C15H11F2IN2O3/c16-15(17)23-10-3-1-2-9(7-10)20-12-5-4-8(14(21)22)6-11(12)13(18)19/h1-7,15,19-20H,(H,21,22)/b19-13- |
| InChIKey | NOYAYWNPLZGRDE-UYRXBGFRSA-N |
| XLogP | 4.49 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.16 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|