C20H19F4N3O4S — CID 166858508
3-(2,2-difluoroethanimidoyl)-4-[3-(difluoromethoxy)anilino]-N-(3-methyl-1,1-dioxothietan-3-yl)benzamide (PubChem CID 166858508) has the molecular formula C20H19F4N3O4S and a molecular weight of 473.45 g/mol. Its IUPAC name is 3-(2,2-difluoroethanimidoyl)-4-[3-(difluoromethoxy)anilino]-N-(3-methyl-1,1-dioxothietan-3-yl)benzamide.
| Compound Name | 3-(2,2-difluoroethanimidoyl)-4-[3-(difluoromethoxy)anilino]-N-(3-methyl-1,1-dioxothietan-3-yl)benzamide |
|---|---|
| PubChem CID | 166858508 |
| Molecular Formula | C20H19F4N3O4S |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 3-(2,2-difluoroethanimidoyl)-4-[3-(difluoromethoxy)anilino]-N-(3-methyl-1,1-dioxothietan-3-yl)benzamide |
| SMILES | [H]/N=C(/c1cc(C(=O)NC2(C)CS(=O)(=O)C2)ccc1Nc1cccc(OC(F)F)c1)C(F)F |
| InChI | InChI=1S/C20H19F4N3O4S/c1-20(9-32(29,30)10-20)27-18(28)11-5-6-15(14(7-11)16(25)17(21)22)26-12-3-2-4-13(8-12)31-19(23)24/h2-8,17,19,25-26H,9-10H2,1H3,(H,27,28)/b25-16- |
| InChIKey | ATARFUGOPBSTKY-XYGWBWBKSA-N |
| XLogP | 3.58 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|