C22H28F2N4O3S — CID 162359013
6-[3-(difluoromethoxy)benzenecarboximidoyl]-5-(propan-2-ylamino)pyridine-3-carbaldehyde;N,3-dimethyl-1-oxothietan-3-amine (PubChem CID 162359013) has the molecular formula C22H28F2N4O3S and a molecular weight of 466.55 g/mol. Its IUPAC name is 6-[3-(difluoromethoxy)benzenecarboximidoyl]-5-(propan-2-ylamino)pyridine-3-carbaldehyde;N,3-dimethyl-1-oxothietan-3-amine.
| Compound Name | 6-[3-(difluoromethoxy)benzenecarboximidoyl]-5-(propan-2-ylamino)pyridine-3-carbaldehyde;N,3-dimethyl-1-oxothietan-3-amine |
|---|---|
| PubChem CID | 162359013 |
| Molecular Formula | C22H28F2N4O3S |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 6-[3-(difluoromethoxy)benzenecarboximidoyl]-5-(propan-2-ylamino)pyridine-3-carbaldehyde;N,3-dimethyl-1-oxothietan-3-amine |
| SMILES | CNC1(C)CS(=O)C1.[H]/N=C(\c1cccc(OC(F)F)c1)c1ncc(C=O)cc1NC(C)C |
| InChI | InChI=1S/C17H17F2N3O2.C5H11NOS/c1-10(2)22-14-6-11(9-23)8-21-16(14)15(20)12-4-3-5-13(7-12)24-17(18)19;1-5(6-2)3-8(7)4-5/h3-10,17,20,22H,1-2H3;6H,3-4H2,1-2H3/b20-15+; |
| InChIKey | HIJQAXWYFFYSMF-QMGGKDRNSA-N |
| XLogP | 3.46 |
| TPSA | 104.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|