C22H27F3N4O2S — CID 162358970
N,3-dimethylthietan-3-amine;5-(propan-2-ylamino)-6-[3-(trifluoromethoxy)benzenecarboximidoyl]pyridine-3-carbaldehyde (PubChem CID 162358970) has the molecular formula C22H27F3N4O2S and a molecular weight of 468.55 g/mol. Its IUPAC name is N,3-dimethylthietan-3-amine;5-(propan-2-ylamino)-6-[3-(trifluoromethoxy)benzenecarboximidoyl]pyridine-3-carbaldehyde.
| Compound Name | N,3-dimethylthietan-3-amine;5-(propan-2-ylamino)-6-[3-(trifluoromethoxy)benzenecarboximidoyl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 162358970 |
| Molecular Formula | C22H27F3N4O2S |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | N,3-dimethylthietan-3-amine;5-(propan-2-ylamino)-6-[3-(trifluoromethoxy)benzenecarboximidoyl]pyridine-3-carbaldehyde |
| SMILES | CNC1(C)CSC1.[H]/N=C(\c1cccc(OC(F)(F)F)c1)c1ncc(C=O)cc1NC(C)C |
| InChI | InChI=1S/C17H16F3N3O2.C5H11NS/c1-10(2)23-14-6-11(9-24)8-22-16(14)15(21)12-4-3-5-13(7-12)25-17(18,19)20;1-5(6-2)3-7-4-5/h3-10,21,23H,1-2H3;6H,3-4H2,1-2H3/b21-15+; |
| InChIKey | UPRYHRLSGJGXJD-NEMIEIFKSA-N |
| XLogP | 4.74 |
| TPSA | 87.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|