About N-benzyloxolan-2-imine
N-benzyloxolan-2-imine (PubChem CID 14529224) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is N-benzyloxolan-2-imine.
Molecular Properties
| Compound Name | N-benzyloxolan-2-imine |
| PubChem CID | 14529224 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | N-benzyloxolan-2-imine |
| SMILES | c1ccc(C/N=C2/CCCO2)cc1 |
| InChI | InChI=1S/C11H13NO/c1-2-5-10(6-3-1)9-12-11-7-4-8-13-11/h1-3,5-6H,4,7-9H2/b12-11- |
| InChIKey | PIUXCTSTOCPAHB-QXMHVHEDSA-N |
| XLogP | 2.40 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyloxolan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyloxolan-2-imine?
The IUPAC name of N-benzyloxolan-2-imine (CID 14529224) is N-benzyloxolan-2-imine.
What is the SMILES notation for N-benzyloxolan-2-imine?
The canonical SMILES for N-benzyloxolan-2-imine is c1ccc(C/N=C2/CCCO2)cc1.
What is the InChIKey of N-benzyloxolan-2-imine?
The InChIKey is PIUXCTSTOCPAHB-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H13NO/c1-2-5-10(6-3-1)9-12-11-7-4-8-13-11/h1-3,5-6H,4,7-9H2/b12-11-.
What are the key properties of N-benzyloxolan-2-imine?
N-benzyloxolan-2-imine has a molecular weight of 175.23 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyloxolan-2-imine is sourced from PubChem (CID 14529224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).