C14H19NO2 — CID 85389732
N-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanimine (PubChem CID 85389732) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanimine.
| Compound Name | N-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanimine |
|---|---|
| PubChem CID | 85389732 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-benzyl-2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanimine |
| SMILES | CC1(C)OCC(C/C=N/Cc2ccccc2)O1 |
| InChI | InChI=1S/C14H19NO2/c1-14(2)16-11-13(17-14)8-9-15-10-12-6-4-3-5-7-12/h3-7,9,13H,8,10-11H2,1-2H3/b15-9+ |
| InChIKey | YBOPKVAEEQNZJF-OQLLNIDSSA-N |
| XLogP | 2.80 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|