C33H46N4O4 — CID 145294123
3-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenoxy]-N-[2-[[2-[2-[(1Z)-buta-1,3-dienyl]-4-hydroxy-3-(methylamino)phenyl]-2-hydroxyethyl]amino]ethyl]-N-methylpropanamide (PubChem CID 145294123) has the molecular formula C33H46N4O4 and a molecular weight of 562.76 g/mol. Its IUPAC name is 3-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenoxy]-N-[2-[[2-[2-[(1Z)-buta-1,3-dienyl]-4-hydroxy-3-(methylamino)phenyl]-2-hydroxyethyl]amino]ethyl]-N-methylpropanamide.
| Compound Name | 3-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenoxy]-N-[2-[[2-[2-[(1Z)-buta-1,3-dienyl]-4-hydroxy-3-(methylamino)phenyl]-2-hydroxyethyl]amino]ethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 145294123 |
| Molecular Formula | C33H46N4O4 |
| Molecular Weight | 562.76 g/mol |
| Exact Mass | 562.35 |
| IUPAC Name | 3-[4-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-ylmethyl)phenoxy]-N-[2-[[2-[2-[(1Z)-buta-1,3-dienyl]-4-hydroxy-3-(methylamino)phenyl]-2-hydroxyethyl]amino]ethyl]-N-methylpropanamide |
| SMILES | C=C/C=C\c1c(C(O)CNCCN(C)C(=O)CCOc2ccc(CN3CC4CCCC4C3)cc2)ccc(O)c1NC |
| InChI | InChI=1S/C33H46N4O4/c1-4-5-9-29-28(14-15-30(38)33(29)34-2)31(39)20-35-17-18-36(3)32(40)16-19-41-27-12-10-24(11-13-27)21-37-22-25-7-6-8-26(25)23-37/h4-5,9-15,25-26,31,34-35,38-39H,1,6-8,16-23H2,2-3H3/b9-5- |
| InChIKey | IOBRJVISCBLPHY-UITAMQMPSA-N |
| XLogP | 4.42 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.76 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|