About benzaldehyde;ethane;hexan-2-one
benzaldehyde;ethane;hexan-2-one (PubChem CID 145294452) has the molecular formula C15H24O2
and a molecular weight of 236.36 g/mol. Its IUPAC name is benzaldehyde;ethane;hexan-2-one.
Molecular Properties
| Compound Name | benzaldehyde;ethane;hexan-2-one |
| PubChem CID | 145294452 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | benzaldehyde;ethane;hexan-2-one |
| SMILES | CC.CCCCC(C)=O.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H6O.C6H12O.C2H6/c8-6-7-4-2-1-3-5-7;1-3-4-5-6(2)7;1-2/h1-6H;3-5H2,1-2H3;1-2H3 |
| InChIKey | IMLWFIGOVVRHBN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;ethane;hexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;ethane;hexan-2-one?
The IUPAC name of benzaldehyde;ethane;hexan-2-one (CID 145294452) is benzaldehyde;ethane;hexan-2-one.
What is the SMILES notation for benzaldehyde;ethane;hexan-2-one?
The canonical SMILES for benzaldehyde;ethane;hexan-2-one is CC.CCCCC(C)=O.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;ethane;hexan-2-one?
The InChIKey is IMLWFIGOVVRHBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O.C6H12O.C2H6/c8-6-7-4-2-1-3-5-7;1-3-4-5-6(2)7;1-2/h1-6H;3-5H2,1-2H3;1-2H3.
What are the key properties of benzaldehyde;ethane;hexan-2-one?
benzaldehyde;ethane;hexan-2-one has a molecular weight of 236.36 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;ethane;hexan-2-one is sourced from PubChem (CID 145294452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).