About benzaldehyde;diethylboranyl acetate
benzaldehyde;diethylboranyl acetate (PubChem CID 88818595) has the molecular formula C13H19BO3
and a molecular weight of 234.10 g/mol. Its IUPAC name is benzaldehyde;diethylboranyl acetate.
Molecular Properties
| Compound Name | benzaldehyde;diethylboranyl acetate |
| PubChem CID | 88818595 |
| Molecular Formula | C13H19BO3 |
| Molecular Weight | 234.10 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | benzaldehyde;diethylboranyl acetate |
| SMILES | CCB(CC)OC(C)=O.O=Cc1ccccc1 |
| InChI | InChI=1S/C7H6O.C6H13BO2/c8-6-7-4-2-1-3-5-7;1-4-7(5-2)9-6(3)8/h1-6H;4-5H2,1-3H3 |
| InChIKey | WSBCHKOUQZIGAN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.10 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;diethylboranyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;diethylboranyl acetate?
The IUPAC name of benzaldehyde;diethylboranyl acetate (CID 88818595) is benzaldehyde;diethylboranyl acetate.
What is the SMILES notation for benzaldehyde;diethylboranyl acetate?
The canonical SMILES for benzaldehyde;diethylboranyl acetate is CCB(CC)OC(C)=O.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;diethylboranyl acetate?
The InChIKey is WSBCHKOUQZIGAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O.C6H13BO2/c8-6-7-4-2-1-3-5-7;1-4-7(5-2)9-6(3)8/h1-6H;4-5H2,1-3H3.
What are the key properties of benzaldehyde;diethylboranyl acetate?
benzaldehyde;diethylboranyl acetate has a molecular weight of 234.10 g/mol, XLogP of 3.08, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;diethylboranyl acetate is sourced from PubChem (CID 88818595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).