C23H22N6O3 — CID 145296032
1-(1-prop-2-enoylpyrrolidin-3-yl)-3-(4-pyridazin-3-yloxyphenyl)-5,6-dihydroimidazo[4,5-c]pyridin-2-one (PubChem CID 145296032) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 1-(1-prop-2-enoylpyrrolidin-3-yl)-3-(4-pyridazin-3-yloxyphenyl)-5,6-dihydroimidazo[4,5-c]pyridin-2-one.
| Compound Name | 1-(1-prop-2-enoylpyrrolidin-3-yl)-3-(4-pyridazin-3-yloxyphenyl)-5,6-dihydroimidazo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 145296032 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-(1-prop-2-enoylpyrrolidin-3-yl)-3-(4-pyridazin-3-yloxyphenyl)-5,6-dihydroimidazo[4,5-c]pyridin-2-one |
| SMILES | C=CC(=O)N1CCC(n2c3c(n(-c4ccc(Oc5cccnn5)cc4)c2=O)=CNCC=3)C1 |
| InChI | InChI=1S/C23H22N6O3/c1-2-22(30)27-13-10-17(15-27)29-19-9-12-24-14-20(19)28(23(29)31)16-5-7-18(8-6-16)32-21-4-3-11-25-26-21/h2-9,11,14,17,24H,1,10,12-13,15H2 |
| InChIKey | DTMKRRROIQZDCV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|