C19H24F2N3O2+ — CID 145297202
ethane;[2-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethylamino]-2-oxoethyl]azanium (PubChem CID 145297202) has the molecular formula C19H24F2N3O2+ and a molecular weight of 364.42 g/mol. Its IUPAC name is ethane;[2-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethylamino]-2-oxoethyl]azanium.
| Compound Name | ethane;[2-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 145297202 |
| Molecular Formula | C19H24F2N3O2+ |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | ethane;[2-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethylamino]-2-oxoethyl]azanium |
| SMILES | CC.[NH3+]CC(=O)NCCNC(=O)c1cc(-c2ccccc2F)ccc1F |
| InChI | InChI=1S/C17H17F2N3O2.C2H6/c18-14-4-2-1-3-12(14)11-5-6-15(19)13(9-11)17(24)22-8-7-21-16(23)10-20;1-2/h1-6,9H,7-8,10,20H2,(H,21,23)(H,22,24);1-2H3/p+1 |
| InChIKey | ZSUIWDKVTJLKAX-UHFFFAOYSA-O |
| XLogP | 1.75 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|