C23H27F2N3O4 — CID 129047852
tert-butyl N-[(2S)-1-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 129047852) has the molecular formula C23H27F2N3O4 and a molecular weight of 447.48 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 129047852 |
| Molecular Formula | C23H27F2N3O4 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | tert-butyl N-[(2S)-1-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)NCCNC(=O)c1cc(-c2ccccc2F)ccc1F |
| InChI | InChI=1S/C23H27F2N3O4/c1-14(28-22(31)32-23(2,3)4)20(29)26-11-12-27-21(30)17-13-15(9-10-19(17)25)16-7-5-6-8-18(16)24/h5-10,13-14H,11-12H2,1-4H3,(H,26,29)(H,27,30)(H,28,31)/t14-/m0/s1 |
| InChIKey | QYIVTFABPVZQEE-AWEZNQCLSA-N |
| XLogP | 3.39 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|