C25H29F2NO4 — CID 157447097
tert-butyl (3R)-4-[[4-[2-fluoro-5-(2-fluorophenyl)phenyl]-4-oxobutyl]amino]-3-methyl-4-oxobutanoate (PubChem CID 157447097) has the molecular formula C25H29F2NO4 and a molecular weight of 445.51 g/mol. Its IUPAC name is tert-butyl (3R)-4-[[4-[2-fluoro-5-(2-fluorophenyl)phenyl]-4-oxobutyl]amino]-3-methyl-4-oxobutanoate.
| Compound Name | tert-butyl (3R)-4-[[4-[2-fluoro-5-(2-fluorophenyl)phenyl]-4-oxobutyl]amino]-3-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 157447097 |
| Molecular Formula | C25H29F2NO4 |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | tert-butyl (3R)-4-[[4-[2-fluoro-5-(2-fluorophenyl)phenyl]-4-oxobutyl]amino]-3-methyl-4-oxobutanoate |
| SMILES | C[C@H](CC(=O)OC(C)(C)C)C(=O)NCCCC(=O)c1cc(-c2ccccc2F)ccc1F |
| InChI | InChI=1S/C25H29F2NO4/c1-16(14-23(30)32-25(2,3)4)24(31)28-13-7-10-22(29)19-15-17(11-12-21(19)27)18-8-5-6-9-20(18)26/h5-6,8-9,11-12,15-16H,7,10,13-14H2,1-4H3,(H,28,31)/t16-/m1/s1 |
| InChIKey | BSISRYMXNJNELH-MRXNPFEDSA-N |
| XLogP | 5.08 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|