C20H22F2N2O3 — CID 129048291
tert-butyl N-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethyl]carbamate (PubChem CID 129048291) has the molecular formula C20H22F2N2O3 and a molecular weight of 376.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 129048291 |
| Molecular Formula | C20H22F2N2O3 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | tert-butyl N-[2-[[2-fluoro-5-(2-fluorophenyl)benzoyl]amino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)c1cc(-c2ccccc2F)ccc1F |
| InChI | InChI=1S/C20H22F2N2O3/c1-20(2,3)27-19(26)24-11-10-23-18(25)15-12-13(8-9-17(15)22)14-6-4-5-7-16(14)21/h4-9,12H,10-11H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | GRKKFYICFJCZEV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|