C11H10Cl2N2O — CID 145299025
4,5-dichloro-2-[(2E)-2-ethenylpenta-2,4-dienyl]pyridazin-3-one (PubChem CID 145299025) has the molecular formula C11H10Cl2N2O and a molecular weight of 257.12 g/mol. Its IUPAC name is 4,5-dichloro-2-[(2E)-2-ethenylpenta-2,4-dienyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[(2E)-2-ethenylpenta-2,4-dienyl]pyridazin-3-one |
|---|---|
| PubChem CID | 145299025 |
| Molecular Formula | C11H10Cl2N2O |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 4,5-dichloro-2-[(2E)-2-ethenylpenta-2,4-dienyl]pyridazin-3-one |
| SMILES | C=C/C=C(\C=C)Cn1ncc(Cl)c(Cl)c1=O |
| InChI | InChI=1S/C11H10Cl2N2O/c1-3-5-8(4-2)7-15-11(16)10(13)9(12)6-14-15/h3-6H,1-2,7H2/b8-5+ |
| InChIKey | SZSNUMDEERIWAY-VMPITWQZSA-N |
| XLogP | 2.85 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|