C14H20N2O — CID 145299053
ethane;2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one (PubChem CID 145299053) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is ethane;2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one.
| Compound Name | ethane;2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one |
|---|---|
| PubChem CID | 145299053 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | ethane;2-[(2E)-2-ethenylpenta-2,4-dienyl]-5-methylpyridazin-3-one |
| SMILES | C=C/C=C(\C=C)Cn1ncc(C)cc1=O.CC |
| InChI | InChI=1S/C12H14N2O.C2H6/c1-4-6-11(5-2)9-14-12(15)7-10(3)8-13-14;1-2/h4-8H,1-2,9H2,3H3;1-2H3/b11-6+; |
| InChIKey | PJIVYDKCGAPNGU-ICSBZGNSSA-N |
| XLogP | 2.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|