C13H18N2O — CID 118136027
2-[(2E,4Z)-hepta-2,4-dien-3-yl]-4,5-dimethylpyridazin-3-one (PubChem CID 118136027) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[(2E,4Z)-hepta-2,4-dien-3-yl]-4,5-dimethylpyridazin-3-one.
| Compound Name | 2-[(2E,4Z)-hepta-2,4-dien-3-yl]-4,5-dimethylpyridazin-3-one |
|---|---|
| PubChem CID | 118136027 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-[(2E,4Z)-hepta-2,4-dien-3-yl]-4,5-dimethylpyridazin-3-one |
| SMILES | C/C=C(\C=C/CC)n1ncc(C)c(C)c1=O |
| InChI | InChI=1S/C13H18N2O/c1-5-7-8-12(6-2)15-13(16)11(4)10(3)9-14-15/h6-9H,5H2,1-4H3/b8-7-,12-6+ |
| InChIKey | UYKZPZFNKGAGEY-HRZQEMGZSA-N |
| XLogP | 2.69 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|