C28H26N2 — CID 145299490
(1E,3E)-4-methyl-2-[(11Z)-5-methylidenebenzo[d][1]benzazocin-10-yl]-5-phenylpenta-1,3-dien-1-amine (PubChem CID 145299490) has the molecular formula C28H26N2 and a molecular weight of 390.53 g/mol. Its IUPAC name is (1E,3E)-4-methyl-2-[(11Z)-5-methylidenebenzo[d][1]benzazocin-10-yl]-5-phenylpenta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-4-methyl-2-[(11Z)-5-methylidenebenzo[d][1]benzazocin-10-yl]-5-phenylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145299490 |
| Molecular Formula | C28H26N2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | (1E,3E)-4-methyl-2-[(11Z)-5-methylidenebenzo[d][1]benzazocin-10-yl]-5-phenylpenta-1,3-dien-1-amine |
| SMILES | C=C1c2ccccc2/C=C\N(C(/C=C(\C)Cc2ccccc2)=C/N)c2ccccc21 |
| InChI | InChI=1S/C28H26N2/c1-21(18-23-10-4-3-5-11-23)19-25(20-29)30-17-16-24-12-6-7-13-26(24)22(2)27-14-8-9-15-28(27)30/h3-17,19-20H,2,18,29H2,1H3/b17-16-,21-19+,25-20+ |
| InChIKey | FRICDTGNENRRLQ-AHVNKWRJSA-N |
| XLogP | 6.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|