C30H40 — CID 145300566
(1R)-1-methyl-2-[3-[4-[(2S)-octan-2-yl]cyclohexyl]phenyl]-1H-indene (PubChem CID 145300566) has the molecular formula C30H40 and a molecular weight of 400.65 g/mol. Its IUPAC name is (1R)-1-methyl-2-[3-[4-[(2S)-octan-2-yl]cyclohexyl]phenyl]-1H-indene.
| Compound Name | (1R)-1-methyl-2-[3-[4-[(2S)-octan-2-yl]cyclohexyl]phenyl]-1H-indene |
|---|---|
| PubChem CID | 145300566 |
| Molecular Formula | C30H40 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.31 |
| IUPAC Name | (1R)-1-methyl-2-[3-[4-[(2S)-octan-2-yl]cyclohexyl]phenyl]-1H-indene |
| SMILES | CCCCCC[C@H](C)C1CCC(c2cccc(C3=Cc4ccccc4[C@H]3C)c2)CC1 |
| InChI | InChI=1S/C30H40/c1-4-5-6-7-11-22(2)24-16-18-25(19-17-24)26-13-10-14-27(20-26)30-21-28-12-8-9-15-29(28)23(30)3/h8-10,12-15,20-25H,4-7,11,16-19H2,1-3H3/t22-,23+,24?,25?/m0/s1 |
| InChIKey | BBLQFZYENSJPGQ-IQCRSTAESA-N |
| XLogP | 9.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|