C22H36IO4S- — CID 145301563
2-[5-(4-methylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl]-5-[(6-methylthian-3-yl)methyliodanuidyl]-1,3-dioxane (PubChem CID 145301563) has the molecular formula C22H36IO4S- and a molecular weight of 523.50 g/mol. Its IUPAC name is 2-[5-(4-methylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl]-5-[(6-methylthian-3-yl)methyliodanuidyl]-1,3-dioxane.
| Compound Name | 2-[5-(4-methylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl]-5-[(6-methylthian-3-yl)methyliodanuidyl]-1,3-dioxane |
|---|---|
| PubChem CID | 145301563 |
| Molecular Formula | C22H36IO4S- |
| Molecular Weight | 523.50 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 2-[5-(4-methylcyclohex-3-en-1-yl)-1,3-dioxan-2-yl]-5-[(6-methylthian-3-yl)methyliodanuidyl]-1,3-dioxane |
| SMILES | CC1=CCC(C2COC(C3OCC([I-]CC4CCC(C)SC4)CO3)OC2)CC1 |
| InChI | InChI=1S/C22H36IO4S/c1-15-3-7-18(8-4-15)19-10-24-21(25-11-19)22-26-12-20(13-27-22)23-9-17-6-5-16(2)28-14-17/h3,16-22H,4-14H2,1-2H3/q-1 |
| InChIKey | RRWVBGYSULJIQE-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.50 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|