C18H30O2 — CID 155378283
(5R)-5-methyl-2-[(2S)-5-[(1R)-4-methylcyclohex-3-en-1-yl]oxan-2-yl]oxane (PubChem CID 155378283) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (5R)-5-methyl-2-[(2S)-5-[(1R)-4-methylcyclohex-3-en-1-yl]oxan-2-yl]oxane.
| Compound Name | (5R)-5-methyl-2-[(2S)-5-[(1R)-4-methylcyclohex-3-en-1-yl]oxan-2-yl]oxane |
|---|---|
| PubChem CID | 155378283 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (5R)-5-methyl-2-[(2S)-5-[(1R)-4-methylcyclohex-3-en-1-yl]oxan-2-yl]oxane |
| SMILES | CC1=CC[C@H](C2CC[C@@H](C3CC[C@@H](C)CO3)OC2)CC1 |
| InChI | InChI=1S/C18H30O2/c1-13-3-6-15(7-4-13)16-8-10-18(20-12-16)17-9-5-14(2)11-19-17/h3,14-18H,4-12H2,1-2H3/t14-,15+,16?,17?,18+/m1/s1 |
| InChIKey | AXROWSLGVUFLHZ-VGAKTEPXSA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|