C37H35N3 — CID 145303314
N'-[(Z)-3-cyclohexa-1,3-dien-1-yl-1-phenylprop-1-enyl]-1-[5-(methylamino)-6-phenylphenanthren-2-yl]methanediamine (PubChem CID 145303314) has the molecular formula C37H35N3 and a molecular weight of 521.71 g/mol. Its IUPAC name is N'-[(Z)-3-cyclohexa-1,3-dien-1-yl-1-phenylprop-1-enyl]-1-[5-(methylamino)-6-phenylphenanthren-2-yl]methanediamine.
| Compound Name | N'-[(Z)-3-cyclohexa-1,3-dien-1-yl-1-phenylprop-1-enyl]-1-[5-(methylamino)-6-phenylphenanthren-2-yl]methanediamine |
|---|---|
| PubChem CID | 145303314 |
| Molecular Formula | C37H35N3 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | N'-[(Z)-3-cyclohexa-1,3-dien-1-yl-1-phenylprop-1-enyl]-1-[5-(methylamino)-6-phenylphenanthren-2-yl]methanediamine |
| SMILES | CNc1c(-c2ccccc2)ccc2ccc3cc(C(N)N/C(=C\CC4=CC=CCC4)c4ccccc4)ccc3c12 |
| InChI | InChI=1S/C37H35N3/c1-39-36-33(27-13-7-3-8-14-27)23-20-29-18-19-30-25-31(21-22-32(30)35(29)36)37(38)40-34(28-15-9-4-10-16-28)24-17-26-11-5-2-6-12-26/h2-5,7-11,13-16,18-25,37,39-40H,6,12,17,38H2,1H3/b34-24- |
| InChIKey | WQBAGWLIIDEGFP-BCJTWVECSA-N |
| XLogP | 8.96 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|