C20H21N3 — CID 172945535
4-[(E)-[cyclohexa-1,3-dien-1-yl(phenyl)hydrazinylidene]methyl]-N-methylaniline (PubChem CID 172945535) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-[(E)-[cyclohexa-1,3-dien-1-yl(phenyl)hydrazinylidene]methyl]-N-methylaniline.
| Compound Name | 4-[(E)-[cyclohexa-1,3-dien-1-yl(phenyl)hydrazinylidene]methyl]-N-methylaniline |
|---|---|
| PubChem CID | 172945535 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 4-[(E)-[cyclohexa-1,3-dien-1-yl(phenyl)hydrazinylidene]methyl]-N-methylaniline |
| SMILES | CNc1ccc(/C=N/N(C2=CC=CCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H21N3/c1-21-18-14-12-17(13-15-18)16-22-23(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-6,8-10,12-16,21H,7,11H2,1H3/b22-16+ |
| InChIKey | ZIMQEXILPAWVNR-CJLVFECKSA-N |
| XLogP | 4.80 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|