C11H23N — CID 145304897
ethane;(1R,6S)-6-propylcyclohex-3-en-1-amine (PubChem CID 145304897) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is ethane;(1R,6S)-6-propylcyclohex-3-en-1-amine.
| Compound Name | ethane;(1R,6S)-6-propylcyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 145304897 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | ethane;(1R,6S)-6-propylcyclohex-3-en-1-amine |
| SMILES | CC.CCC[C@H]1CC=CC[C@H]1N |
| InChI | InChI=1S/C9H17N.C2H6/c1-2-5-8-6-3-4-7-9(8)10;1-2/h3-4,8-9H,2,5-7,10H2,1H3;1-2H3/t8-,9+;/m0./s1 |
| InChIKey | FQGLXUWNZRAHKA-OULXEKPRSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|