C15H28 — CID 21482570
3,4,5-tripropylcyclohexene (PubChem CID 21482570) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is 3,4,5-tripropylcyclohexene.
| Compound Name | 3,4,5-tripropylcyclohexene |
|---|---|
| PubChem CID | 21482570 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 3,4,5-tripropylcyclohexene |
| SMILES | CCCC1C=CCC(CCC)C1CCC |
| InChI | InChI=1S/C15H28/c1-4-8-13-11-7-12-14(9-5-2)15(13)10-6-3/h7,11,13-15H,4-6,8-10,12H2,1-3H3 |
| InChIKey | RBADGQYEDRUEPL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|