About 3,4,5-tripropylcyclohexene
3,4,5-tripropylcyclohexene (PubChem CID 21482570) has the molecular formula C15H28
and a molecular weight of 208.39 g/mol. Its IUPAC name is 3,4,5-tripropylcyclohexene.
Molecular Properties
| Compound Name | 3,4,5-tripropylcyclohexene |
| PubChem CID | 21482570 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | 3,4,5-tripropylcyclohexene |
| SMILES | CCCC1C=CCC(CCC)C1CCC |
| InChI | InChI=1S/C15H28/c1-4-8-13-11-7-12-14(9-5-2)15(13)10-6-3/h7,11,13-15H,4-6,8-10,12H2,1-3H3 |
| InChIKey | RBADGQYEDRUEPL-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4,5-tripropylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4,5-tripropylcyclohexene?
The IUPAC name of 3,4,5-tripropylcyclohexene (CID 21482570) is 3,4,5-tripropylcyclohexene.
What is the SMILES notation for 3,4,5-tripropylcyclohexene?
The canonical SMILES for 3,4,5-tripropylcyclohexene is CCCC1C=CCC(CCC)C1CCC.
What is the InChIKey of 3,4,5-tripropylcyclohexene?
The InChIKey is RBADGQYEDRUEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28/c1-4-8-13-11-7-12-14(9-5-2)15(13)10-6-3/h7,11,13-15H,4-6,8-10,12H2,1-3H3.
What are the key properties of 3,4,5-tripropylcyclohexene?
3,4,5-tripropylcyclohexene has a molecular weight of 208.39 g/mol, XLogP of 5.20, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4,5-tripropylcyclohexene is sourced from PubChem (CID 21482570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).