C6H11N7O2 — CID 145309316
N-[[2-[5-(2-aminoethyl)tetrazol-1-yl]acetyl]amino]formamide (PubChem CID 145309316) has the molecular formula C6H11N7O2 and a molecular weight of 213.20 g/mol. Its IUPAC name is N-[[2-[5-(2-aminoethyl)tetrazol-1-yl]acetyl]amino]formamide.
| Compound Name | N-[[2-[5-(2-aminoethyl)tetrazol-1-yl]acetyl]amino]formamide |
|---|---|
| PubChem CID | 145309316 |
| Molecular Formula | C6H11N7O2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-[[2-[5-(2-aminoethyl)tetrazol-1-yl]acetyl]amino]formamide |
| SMILES | NCCc1nnnn1CC(=O)NNC=O |
| InChI | InChI=1S/C6H11N7O2/c7-2-1-5-9-11-12-13(5)3-6(15)10-8-4-14/h4H,1-3,7H2,(H,8,14)(H,10,15) |
| InChIKey | GCOAOQXYJZHPBZ-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|