C29H37ClN7O2P — CID 145311255
5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-(4-piperazin-1-ylpiperidin-1-yl)-2,3-dihydro-1-benzofuran-7-yl]pyrimidine-2,4-diamine (PubChem CID 145311255) has the molecular formula C29H37ClN7O2P and a molecular weight of 582.09 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-(4-piperazin-1-ylpiperidin-1-yl)-2,3-dihydro-1-benzofuran-7-yl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-(4-piperazin-1-ylpiperidin-1-yl)-2,3-dihydro-1-benzofuran-7-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 145311255 |
| Molecular Formula | C29H37ClN7O2P |
| Molecular Weight | 582.09 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[4-(4-piperazin-1-ylpiperidin-1-yl)-2,3-dihydro-1-benzofuran-7-yl]pyrimidine-2,4-diamine |
| SMILES | CP(C)(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCC(N4CCNCC4)CC3)c3c2OCC3)ncc1Cl |
| InChI | InChI=1S/C29H37ClN7O2P/c1-40(2,38)26-6-4-3-5-23(26)33-28-22(30)19-32-29(35-28)34-24-7-8-25(21-11-18-39-27(21)24)37-14-9-20(10-15-37)36-16-12-31-13-17-36/h3-8,19-20,31H,9-18H2,1-2H3,(H2,32,33,34,35) |
| InChIKey | LDMMEBQGEJPBSW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.09 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|