C11H24O3 — CID 145311557
ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol (PubChem CID 145311557) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol.
| Compound Name | ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol |
|---|---|
| PubChem CID | 145311557 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol |
| SMILES | CC.CCCC1OCCC(CCO)O1 |
| InChI | InChI=1S/C9H18O3.C2H6/c1-2-3-9-11-7-5-8(12-9)4-6-10;1-2/h8-10H,2-7H2,1H3;1-2H3 |
| InChIKey | HQGCYXKTXSCKOO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |