About ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol
ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol (PubChem CID 145311557) has the molecular formula C11H24O3
and a molecular weight of 204.31 g/mol. Its IUPAC name is ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol.
Molecular Properties
| Compound Name | ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol |
| PubChem CID | 145311557 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol |
| SMILES | CC.CCCC1OCCC(CCO)O1 |
| InChI | InChI=1S/C9H18O3.C2H6/c1-2-3-9-11-7-5-8(12-9)4-6-10;1-2/h8-10H,2-7H2,1H3;1-2H3 |
| InChIKey | HQGCYXKTXSCKOO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol?
The IUPAC name of ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol (CID 145311557) is ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol.
What is the SMILES notation for ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol?
The canonical SMILES for ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol is CC.CCCC1OCCC(CCO)O1.
What is the InChIKey of ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol?
The InChIKey is HQGCYXKTXSCKOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O3.C2H6/c1-2-3-9-11-7-5-8(12-9)4-6-10;1-2/h8-10H,2-7H2,1H3;1-2H3.
What are the key properties of ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol?
ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol has a molecular weight of 204.31 g/mol, XLogP of 2.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2-propyl-1,3-dioxan-4-yl)ethanol is sourced from PubChem (CID 145311557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).