C11H22O2 — CID 130978706
2-[(2R,6S)-6-tert-butyloxan-2-yl]ethanol (PubChem CID 130978706) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-[(2R,6S)-6-tert-butyloxan-2-yl]ethanol.
| Compound Name | 2-[(2R,6S)-6-tert-butyloxan-2-yl]ethanol |
|---|---|
| PubChem CID | 130978706 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-[(2R,6S)-6-tert-butyloxan-2-yl]ethanol |
| SMILES | CC(C)(C)[C@@H]1CCC[C@H](CCO)O1 |
| InChI | InChI=1S/C11H22O2/c1-11(2,3)10-6-4-5-9(13-10)7-8-12/h9-10,12H,4-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | KXEIHNQFRVEOEQ-ZJUUUORDSA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |