C10H6F2N2 — CID 145311742
5,7-difluoro-4-methyl-1H-indole-2-carbonitrile (PubChem CID 145311742) has the molecular formula C10H6F2N2 and a molecular weight of 192.17 g/mol. Its IUPAC name is 5,7-difluoro-4-methyl-1H-indole-2-carbonitrile.
| Compound Name | 5,7-difluoro-4-methyl-1H-indole-2-carbonitrile |
|---|---|
| PubChem CID | 145311742 |
| Molecular Formula | C10H6F2N2 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 5,7-difluoro-4-methyl-1H-indole-2-carbonitrile |
| SMILES | Cc1c(F)cc(F)c2[nH]c(C#N)cc12 |
| InChI | InChI=1S/C10H6F2N2/c1-5-7-2-6(4-13)14-10(7)9(12)3-8(5)11/h2-3,14H,1H3 |
| InChIKey | AGMKTCJFAGVIMK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |