About 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile
4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile (PubChem CID 140974064) has the molecular formula C10H9N3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile.
Analyze 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile?
The IUPAC name of 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile (CID 140974064) is 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile.
What is the SMILES notation for 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile?
The canonical SMILES for 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile is Cc1cc(C)c2cc(C#N)[nH]c2n1.
What is the InChIKey of 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile?
The InChIKey is SRHTUTQRRNDUTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3/c1-6-3-7(2)12-10-9(6)4-8(5-11)13-10/h3-4H,1-2H3,(H,12,13).
What are the key properties of 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile?
4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile has a molecular weight of 171.20 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethyl-1H-pyrrolo[2,3-b]pyridine-2-carbonitrile is sourced from PubChem (CID 140974064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).