C9H10FN — CID 145311775
3-fluoro-2-methyl-5,6-dihydro-1H-indole (PubChem CID 145311775) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is 3-fluoro-2-methyl-5,6-dihydro-1H-indole.
| Compound Name | 3-fluoro-2-methyl-5,6-dihydro-1H-indole |
|---|---|
| PubChem CID | 145311775 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 3-fluoro-2-methyl-5,6-dihydro-1H-indole |
| SMILES | Cc1[nH]c2c(c1F)=CCCC=2 |
| InChI | InChI=1S/C9H10FN/c1-6-9(10)7-4-2-3-5-8(7)11-6/h4-5,11H,2-3H2,1H3 |
| InChIKey | BERTXWIITNLDSD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |