C22H41FO — CID 145312701
1-[[(E)-1-fluorodec-4-en-2-yl]oxymethyl]-4-pentylcyclohexane (PubChem CID 145312701) has the molecular formula C22H41FO and a molecular weight of 340.57 g/mol. Its IUPAC name is 1-[[(E)-1-fluorodec-4-en-2-yl]oxymethyl]-4-pentylcyclohexane.
| Compound Name | 1-[[(E)-1-fluorodec-4-en-2-yl]oxymethyl]-4-pentylcyclohexane |
|---|---|
| PubChem CID | 145312701 |
| Molecular Formula | C22H41FO |
| Molecular Weight | 340.57 g/mol |
| Exact Mass | 340.31 |
| IUPAC Name | 1-[[(E)-1-fluorodec-4-en-2-yl]oxymethyl]-4-pentylcyclohexane |
| SMILES | CCCCC/C=C/CC(CF)OCC1CCC(CCCCC)CC1 |
| InChI | InChI=1S/C22H41FO/c1-3-5-7-8-9-11-13-22(18-23)24-19-21-16-14-20(15-17-21)12-10-6-4-2/h9,11,20-22H,3-8,10,12-19H2,1-2H3/b11-9+ |
| InChIKey | JAJAYMQMIHJKDW-PKNBQFBNSA-N |
| XLogP | 7.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.57 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|