About 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate
6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate (PubChem CID 145314555) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate.
Molecular Properties
| Compound Name | 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate |
| PubChem CID | 145314555 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate |
| SMILES | CCC/C=C\C(=O)OCCCCCCN1CCCC1=O |
| InChI | InChI=1S/C16H27NO3/c1-2-3-6-11-16(19)20-14-8-5-4-7-12-17-13-9-10-15(17)18/h6,11H,2-5,7-10,12-14H2,1H3/b11-6- |
| InChIKey | GIKVJXLVRIANGS-WDZFZDKYSA-N |
| XLogP | 3.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate?
The IUPAC name of 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate (CID 145314555) is 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate.
What is the SMILES notation for 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate?
The canonical SMILES for 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate is CCC/C=C\C(=O)OCCCCCCN1CCCC1=O.
What is the InChIKey of 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate?
The InChIKey is GIKVJXLVRIANGS-WDZFZDKYSA-N. The full InChI is InChI=1S/C16H27NO3/c1-2-3-6-11-16(19)20-14-8-5-4-7-12-17-13-9-10-15(17)18/h6,11H,2-5,7-10,12-14H2,1H3/b11-6-.
What are the key properties of 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate?
6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate has a molecular weight of 281.40 g/mol, XLogP of 3.07, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-oxopyrrolidin-1-yl)hexyl (Z)-hex-2-enoate is sourced from PubChem (CID 145314555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).