C14H15NO — CID 145317832
(3Z)-5-[(4-methylphenyl)methylideneamino]hexa-1,3,5-trien-2-ol (PubChem CID 145317832) has the molecular formula C14H15NO and a molecular weight of 213.28 g/mol. Its IUPAC name is (3Z)-5-[(4-methylphenyl)methylideneamino]hexa-1,3,5-trien-2-ol.
| Compound Name | (3Z)-5-[(4-methylphenyl)methylideneamino]hexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 145317832 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | (3Z)-5-[(4-methylphenyl)methylideneamino]hexa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)/N=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C14H15NO/c1-11-4-8-14(9-5-11)10-15-12(2)6-7-13(3)16/h4-10,16H,2-3H2,1H3/b7-6-,15-10+ |
| InChIKey | IDMLFCXKBXYZSL-GZJRMXIGSA-N |
| XLogP | 3.56 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|