C28H28ClF2N3O3 — CID 145318751
4-(10-chloro-2-hydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl)benzonitrile;2,2-difluoro-N,N-dimethylethanamine (PubChem CID 145318751) has the molecular formula C28H28ClF2N3O3 and a molecular weight of 528.00 g/mol. Its IUPAC name is 4-(10-chloro-2-hydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl)benzonitrile;2,2-difluoro-N,N-dimethylethanamine.
| Compound Name | 4-(10-chloro-2-hydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl)benzonitrile;2,2-difluoro-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 145318751 |
| Molecular Formula | C28H28ClF2N3O3 |
| Molecular Weight | 528.00 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 4-(10-chloro-2-hydroxy-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl)benzonitrile;2,2-difluoro-N,N-dimethylethanamine |
| SMILES | CN(C)CC(F)F.COc1nc(Cl)cc2c1C1(O)CCC(c3ccccc3)C1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C24H19ClN2O3.C4H9F2N/c1-29-22-21-19(13-20(25)27-22)30-24(17-9-7-15(14-26)8-10-17)18(11-12-23(21,24)28)16-5-3-2-4-6-16;1-7(2)3-4(5)6/h2-10,13,18,28H,11-12H2,1H3;4H,3H2,1-2H3 |
| InChIKey | HAPMEQDGMFOUIK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.00 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|