C32H31N3O3 — CID 145318802
4-[(2R,5S,6R)-2-hydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile;N-methyl-1-phenylmethanamine (PubChem CID 145318802) has the molecular formula C32H31N3O3 and a molecular weight of 505.62 g/mol. Its IUPAC name is 4-[(2R,5S,6R)-2-hydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile;N-methyl-1-phenylmethanamine.
| Compound Name | 4-[(2R,5S,6R)-2-hydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 145318802 |
| Molecular Formula | C32H31N3O3 |
| Molecular Weight | 505.62 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | 4-[(2R,5S,6R)-2-hydroxy-12-methoxy-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-6-yl]benzonitrile;N-methyl-1-phenylmethanamine |
| SMILES | CNCc1ccccc1.COc1cncc2c1[C@]1(O)CC[C@@H](c3ccccc3)[C@]1(c1ccc(C#N)cc1)O2 |
| InChI | InChI=1S/C24H20N2O3.C8H11N/c1-28-20-14-26-15-21-22(20)23(27)12-11-19(17-5-3-2-4-6-17)24(23,29-21)18-9-7-16(13-25)8-10-18;1-9-7-8-5-3-2-4-6-8/h2-10,14-15,19,27H,11-12H2,1H3;2-6,9H,7H2,1H3/t19-,23+,24-;/m0./s1 |
| InChIKey | WOXYZTIMHXWDAD-DZCBXEEYSA-N |
| XLogP | 5.42 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |